About methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate
methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate (PubChem CID 35361183) has the molecular formula C8H12N2O4S
and a molecular weight of 232.26 g/mol. Its IUPAC name is methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate |
| PubChem CID | 35361183 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate |
| SMILES | COC(=O)CSCCN1C(=O)CNC1=O |
| InChI | InChI=1S/C8H12N2O4S/c1-14-7(12)5-15-3-2-10-6(11)4-9-8(10)13/h2-5H2,1H3,(H,9,13) |
| InChIKey | FHSJQJNSWIWURT-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate?
The IUPAC name of methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate (CID 35361183) is methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate.
What is the SMILES notation for methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate?
The canonical SMILES for methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate is COC(=O)CSCCN1C(=O)CNC1=O.
What is the InChIKey of methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate?
The InChIKey is FHSJQJNSWIWURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S/c1-14-7(12)5-15-3-2-10-6(11)4-9-8(10)13/h2-5H2,1H3,(H,9,13).
What are the key properties of methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate?
methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate has a molecular weight of 232.26 g/mol, XLogP of -0.56, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2,5-dioxoimidazolidin-1-yl)ethylsulfanyl]acetate is sourced from PubChem (CID 35361183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).