C19H25N5S — CID 3536363
2-(3,5-dimethylpyrazol-1-yl)-N,N-diethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 3536363) has the molecular formula C19H25N5S and a molecular weight of 355.51 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N,N-diethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N,N-diethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 3536363 |
| Molecular Formula | C19H25N5S |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N,N-diethyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCN(CC)c1nc(-n2nc(C)cc2C)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C19H25N5S/c1-5-23(6-2)17-16-14-9-7-8-10-15(14)25-18(16)21-19(20-17)24-13(4)11-12(3)22-24/h11H,5-10H2,1-4H3 |
| InChIKey | YZSIKQNGZNWPOY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |