About 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid
3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid (PubChem CID 3536450) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid |
| PubChem CID | 3536450 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid |
| SMILES | NC(CC(=O)O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H13NO4/c12-8(6-11(13)14)7-1-2-9-10(5-7)16-4-3-15-9/h1-2,5,8H,3-4,6,12H2,(H,13,14) |
| InChIKey | CAGUEQZBLIGCEU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid?
The IUPAC name of 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid (CID 3536450) is 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid.
What is the SMILES notation for 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid?
The canonical SMILES for 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid is NC(CC(=O)O)c1ccc2c(c1)OCCO2.
What is the InChIKey of 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid?
The InChIKey is CAGUEQZBLIGCEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c12-8(6-11(13)14)7-1-2-9-10(5-7)16-4-3-15-9/h1-2,5,8H,3-4,6,12H2,(H,13,14).
What are the key properties of 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid?
3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid has a molecular weight of 223.23 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanoic acid is sourced from PubChem (CID 3536450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).