C17H16N4 — CID 3537199
1-ethyl-3-phenyl-4H-[1,2,4]triazino[4,3-a]benzimidazole (PubChem CID 3537199) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-ethyl-3-phenyl-4H-[1,2,4]triazino[4,3-a]benzimidazole.
| Compound Name | 1-ethyl-3-phenyl-4H-[1,2,4]triazino[4,3-a]benzimidazole |
|---|---|
| PubChem CID | 3537199 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-ethyl-3-phenyl-4H-[1,2,4]triazino[4,3-a]benzimidazole |
| SMILES | CCN1N=C(c2ccccc2)Cn2c1nc1ccccc12 |
| InChI | InChI=1S/C17H16N4/c1-2-21-17-18-14-10-6-7-11-16(14)20(17)12-15(19-21)13-8-4-3-5-9-13/h3-11H,2,12H2,1H3 |
| InChIKey | UKFYAOLFCMWYQE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |