C17H15Cl3N4O3S — CID 3537451
2-methyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 3537451) has the molecular formula C17H15Cl3N4O3S and a molecular weight of 461.76 g/mol. Its IUPAC name is 2-methyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 2-methyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 3537451 |
| Molecular Formula | C17H15Cl3N4O3S |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | 2-methyl-N-[2,2,2-trichloro-1-[(4-nitrophenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(NC(=S)Nc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H15Cl3N4O3S/c1-10-4-2-3-5-13(10)14(25)22-15(17(18,19)20)23-16(28)21-11-6-8-12(9-7-11)24(26)27/h2-9,15H,1H3,(H,22,25)(H2,21,23,28) |
| InChIKey | ZSWMAYIWAYRKAL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|