About 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one
1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 3538278) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one |
| PubChem CID | 3538278 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | O=C(CCn1cncn1)c1ccccc1 |
| InChI | InChI=1S/C11H11N3O/c15-11(10-4-2-1-3-5-10)6-7-14-9-12-8-13-14/h1-5,8-9H,6-7H2 |
| InChIKey | CFXOYNIAUWOYDU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one?
The IUPAC name of 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one (CID 3538278) is 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one.
What is the SMILES notation for 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one?
The canonical SMILES for 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one is O=C(CCn1cncn1)c1ccccc1.
What is the InChIKey of 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one?
The InChIKey is CFXOYNIAUWOYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c15-11(10-4-2-1-3-5-10)6-7-14-9-12-8-13-14/h1-5,8-9H,6-7H2.
What are the key properties of 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one?
1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one has a molecular weight of 201.23 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-(1,2,4-triazol-1-yl)propan-1-one is sourced from PubChem (CID 3538278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).