C41H49F2NO7 — CID 3538335
ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate (PubChem CID 3538335) has the molecular formula C41H49F2NO7 and a molecular weight of 705.84 g/mol. Its IUPAC name is ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate.
| Compound Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 3538335 |
| Molecular Formula | C41H49F2NO7 |
| Molecular Weight | 705.84 g/mol |
| Exact Mass | 705.35 |
| IUPAC Name | ethyl N-[[17-(3,4-difluorobenzoyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[(2,4-dimethoxyphenyl)methyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccc(OC)cc1OC)CC1(O)CCC2c3ccc(cc3C(=O)c3ccc(F)c(F)c3)CC(O)CCC(C)=CCCC21C |
| InChI | InChI=1S/C41H49F2NO7/c1-6-51-39(47)44(24-29-11-14-31(49-4)23-37(29)50-5)25-41(48)19-17-34-32-15-10-27(20-30(45)13-9-26(2)8-7-18-40(34,41)3)21-33(32)38(46)28-12-16-35(42)36(43)22-28/h8,10-12,14-16,21-23,30,34,45,48H,6-7,9,13,17-20,24-25H2,1-5H3 |
| InChIKey | QDAKIRQLMYIIJE-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.84 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|