C32H26Cl2N4O4S2 — CID 3538509
N-[2-[2,2-dichloro-1-(4-methylphenyl)sulfonylethenyl]-4-(4-methoxyphenyl)-3-oxo-1,2,4-thiadiazolidin-5-ylidene]-N'-(4-methylphenyl)benzenecarboximidamide (PubChem CID 3538509) has the molecular formula C32H26Cl2N4O4S2 and a molecular weight of 665.62 g/mol. Its IUPAC name is N-[2-[2,2-dichloro-1-(4-methylphenyl)sulfonylethenyl]-4-(4-methoxyphenyl)-3-oxo-1,2,4-thiadiazolidin-5-ylidene]-N'-(4-methylphenyl)benzenecarboximidamide.
| Compound Name | N-[2-[2,2-dichloro-1-(4-methylphenyl)sulfonylethenyl]-4-(4-methoxyphenyl)-3-oxo-1,2,4-thiadiazolidin-5-ylidene]-N'-(4-methylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 3538509 |
| Molecular Formula | C32H26Cl2N4O4S2 |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 664.08 |
| IUPAC Name | N-[2-[2,2-dichloro-1-(4-methylphenyl)sulfonylethenyl]-4-(4-methoxyphenyl)-3-oxo-1,2,4-thiadiazolidin-5-ylidene]-N'-(4-methylphenyl)benzenecarboximidamide |
| SMILES | COc1ccc(-n2c(=O)n(C(=C(Cl)Cl)S(=O)(=O)c3ccc(C)cc3)s/c2=N\C(=N\c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H26Cl2N4O4S2/c1-21-9-13-24(14-10-21)35-29(23-7-5-4-6-8-23)36-31-37(25-15-17-26(42-3)18-16-25)32(39)38(43-31)30(28(33)34)44(40,41)27-19-11-22(2)12-20-27/h4-20H,1-3H3/b35-29+,36-31- |
| InChIKey | LHEZKHFZPSZVDY-LEGHUOSCSA-N |
| XLogP | 7.04 |
| TPSA | 95.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|