About quinoline-2-carboxylate
quinoline-2-carboxylate (PubChem CID 3538644) has the molecular formula C10H6NO2-
and a molecular weight of 172.16 g/mol. Its IUPAC name is quinoline-2-carboxylate.
Molecular Properties
| Compound Name | quinoline-2-carboxylate |
| PubChem CID | 3538644 |
| Molecular Formula | C10H6NO2- |
| Molecular Weight | 172.16 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | quinoline-2-carboxylate |
| SMILES | O=C([O-])c1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H,12,13)/p-1 |
| InChIKey | LOAUVZALPPNFOQ-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-2-carboxylate?
The IUPAC name of quinoline-2-carboxylate (CID 3538644) is quinoline-2-carboxylate.
What is the SMILES notation for quinoline-2-carboxylate?
The canonical SMILES for quinoline-2-carboxylate is O=C([O-])c1ccc2ccccc2n1.
What is the InChIKey of quinoline-2-carboxylate?
The InChIKey is LOAUVZALPPNFOQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H7NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H,12,13)/p-1.
What are the key properties of quinoline-2-carboxylate?
quinoline-2-carboxylate has a molecular weight of 172.16 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-2-carboxylate is sourced from PubChem (CID 3538644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).