C12H10Cl2O6 — CID 3538931
diethyl 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate (PubChem CID 3538931) has the molecular formula C12H10Cl2O6 and a molecular weight of 321.11 g/mol. Its IUPAC name is diethyl 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate.
| Compound Name | diethyl 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 3538931 |
| Molecular Formula | C12H10Cl2O6 |
| Molecular Weight | 321.11 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | diethyl 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(Cl)C(=O)C(C(=O)OCC)=C(Cl)C1=O |
| InChI | InChI=1S/C12H10Cl2O6/c1-3-19-11(17)5-7(13)10(16)6(8(14)9(5)15)12(18)20-4-2/h3-4H2,1-2H3 |
| InChIKey | DSMAZEQMNOMCNY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|