About 3-acetyl-1,3-thiazolidin-2-one
3-acetyl-1,3-thiazolidin-2-one (PubChem CID 3539492) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-acetyl-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 3-acetyl-1,3-thiazolidin-2-one |
| PubChem CID | 3539492 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 3-acetyl-1,3-thiazolidin-2-one |
| SMILES | CC(=O)N1CCSC1=O |
| InChI | InChI=1S/C5H7NO2S/c1-4(7)6-2-3-9-5(6)8/h2-3H2,1H3 |
| InChIKey | SFOSMNUQKPZHHC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-1,3-thiazolidin-2-one?
The IUPAC name of 3-acetyl-1,3-thiazolidin-2-one (CID 3539492) is 3-acetyl-1,3-thiazolidin-2-one.
What is the SMILES notation for 3-acetyl-1,3-thiazolidin-2-one?
The canonical SMILES for 3-acetyl-1,3-thiazolidin-2-one is CC(=O)N1CCSC1=O.
What is the InChIKey of 3-acetyl-1,3-thiazolidin-2-one?
The InChIKey is SFOSMNUQKPZHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c1-4(7)6-2-3-9-5(6)8/h2-3H2,1H3.
What are the key properties of 3-acetyl-1,3-thiazolidin-2-one?
3-acetyl-1,3-thiazolidin-2-one has a molecular weight of 145.18 g/mol, XLogP of 0.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-1,3-thiazolidin-2-one is sourced from PubChem (CID 3539492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).