C18H22N2O5S — CID 3539587
3,4,5-trimethoxy-N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]benzamide (PubChem CID 3539587) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 3539587 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-oxo-3-(thiophen-2-ylmethylamino)propyl]benzamide |
| SMILES | COc1cc(C(=O)NCCC(=O)NCc2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22N2O5S/c1-23-14-9-12(10-15(24-2)17(14)25-3)18(22)19-7-6-16(21)20-11-13-5-4-8-26-13/h4-5,8-10H,6-7,11H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | RMUGNWZZBSMJPF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |