C16H21N3O3 — CID 35396976
1-[(2S)-butan-2-yl]-3-[4-(ethylamino)-2-oxochromen-3-yl]urea (PubChem CID 35396976) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-3-[4-(ethylamino)-2-oxochromen-3-yl]urea.
| Compound Name | 1-[(2S)-butan-2-yl]-3-[4-(ethylamino)-2-oxochromen-3-yl]urea |
|---|---|
| PubChem CID | 35396976 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-3-[4-(ethylamino)-2-oxochromen-3-yl]urea |
| SMILES | CCNc1c(NC(=O)N[C@@H](C)CC)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C16H21N3O3/c1-4-10(3)18-16(21)19-14-13(17-5-2)11-8-6-7-9-12(11)22-15(14)20/h6-10,17H,4-5H2,1-3H3,(H2,18,19,21)/t10-/m0/s1 |
| InChIKey | LHZIGWDDVSAADI-JTQLQIEISA-N |
| XLogP | 3.14 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|