C21H22N2O4S — CID 35397354
N-[4-(cyclohexylamino)-2-oxochromen-3-yl]benzenesulfonamide (PubChem CID 35397354) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[4-(cyclohexylamino)-2-oxochromen-3-yl]benzenesulfonamide.
| Compound Name | N-[4-(cyclohexylamino)-2-oxochromen-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 35397354 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[4-(cyclohexylamino)-2-oxochromen-3-yl]benzenesulfonamide |
| SMILES | O=c1oc2ccccc2c(NC2CCCCC2)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O4S/c24-21-20(23-28(25,26)16-11-5-2-6-12-16)19(22-15-9-3-1-4-10-15)17-13-7-8-14-18(17)27-21/h2,5-8,11-15,22-23H,1,3-4,9-10H2 |
| InChIKey | CWLBDBULELCWDG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|