About 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide
3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide (PubChem CID 3540827) has the molecular formula C15H16Cl2N2O3
and a molecular weight of 343.21 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide |
| PubChem CID | 3540827 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide |
| SMILES | COc1c(Cl)cc(-c2noc(C)c2C(=O)NC(C)C)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O3/c1-7(2)18-15(20)12-8(3)22-19-13(12)9-5-10(16)14(21-4)11(17)6-9/h5-7H,1-4H3,(H,18,20) |
| InChIKey | GMYWMMDJXPCPHC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide (CID 3540827) is 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide is COc1c(Cl)cc(-c2noc(C)c2C(=O)NC(C)C)cc1Cl.
What is the InChIKey of 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide?
The InChIKey is GMYWMMDJXPCPHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Cl2N2O3/c1-7(2)18-15(20)12-8(3)22-19-13(12)9-5-10(16)14(21-4)11(17)6-9/h5-7H,1-4H3,(H,18,20).
What are the key properties of 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide?
3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide has a molecular weight of 343.21 g/mol, XLogP of 4.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichloro-4-methoxyphenyl)-5-methyl-N-propan-2-yl-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 3540827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).