About 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate
2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate (PubChem CID 3541202) has the molecular formula C15H13ClNO4-
and a molecular weight of 306.72 g/mol. Its IUPAC name is 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate |
| PubChem CID | 3541202 |
| Molecular Formula | C15H13ClNO4- |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)[O-] |
| InChI | InChI=1S/C15H14ClNO4/c1-7(2)11(15(20)21)17-12-10(16)13(18)8-5-3-4-6-9(8)14(12)19/h3-7,11,17H,1-2H3,(H,20,21)/p-1 |
| InChIKey | OIPYTSUOFLTABO-UHFFFAOYSA-M |
| XLogP | 0.88 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate?
The IUPAC name of 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate (CID 3541202) is 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate.
What is the SMILES notation for 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate?
The canonical SMILES for 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate is CC(C)C(NC1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)[O-].
What is the InChIKey of 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate?
The InChIKey is OIPYTSUOFLTABO-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14ClNO4/c1-7(2)11(15(20)21)17-12-10(16)13(18)8-5-3-4-6-9(8)14(12)19/h3-7,11,17H,1-2H3,(H,20,21)/p-1.
What are the key properties of 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate?
2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate has a molecular weight of 306.72 g/mol, XLogP of 0.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-3-methylbutanoate is sourced from PubChem (CID 3541202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).