C24H20ClN3O5S2 — CID 3541258
ethyl 3-[(2-chlorophenyl)methyl]-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 3541258) has the molecular formula C24H20ClN3O5S2 and a molecular weight of 530.03 g/mol. Its IUPAC name is ethyl 3-[(2-chlorophenyl)methyl]-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 3-[(2-chlorophenyl)methyl]-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3541258 |
| Molecular Formula | C24H20ClN3O5S2 |
| Molecular Weight | 530.03 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | ethyl 3-[(2-chlorophenyl)methyl]-5-methyl-2-[(3-nitrophenyl)methylsulfanyl]-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(SCc3cccc([N+](=O)[O-])c3)n(Cc3ccccc3Cl)c(=O)c2c1C |
| InChI | InChI=1S/C24H20ClN3O5S2/c1-3-33-23(30)20-14(2)19-21(35-20)26-24(34-13-15-7-6-9-17(11-15)28(31)32)27(22(19)29)12-16-8-4-5-10-18(16)25/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | UXVYWALJCAMJEW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.03 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|