About 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine
3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine (PubChem CID 3541466) has the molecular formula C26H18F3N3O
and a molecular weight of 445.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine |
| PubChem CID | 3541466 |
| Molecular Formula | C26H18F3N3O |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)c3nc(-c4ccccc4)cc(C(F)(F)F)c23)cc1 |
| InChI | InChI=1S/C26H18F3N3O/c1-33-20-14-12-18(13-15-20)24-23-21(26(27,28)29)16-22(17-8-4-2-5-9-17)30-25(23)32(31-24)19-10-6-3-7-11-19/h2-16H,1H3 |
| InChIKey | AUKPPKMXJIXSHL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
The IUPAC name of 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine (CID 3541466) is 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine.
What is the SMILES notation for 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
The canonical SMILES for 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine is COc1ccc(-c2nn(-c3ccccc3)c3nc(-c4ccccc4)cc(C(F)(F)F)c23)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
The InChIKey is AUKPPKMXJIXSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18F3N3O/c1-33-20-14-12-18(13-15-20)24-23-21(26(27,28)29)16-22(17-8-4-2-5-9-17)30-25(23)32(31-24)19-10-6-3-7-11-19/h2-16H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine?
3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine has a molecular weight of 445.44 g/mol, XLogP of 6.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1,6-diphenyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine is sourced from PubChem (CID 3541466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).