About 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide
1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 35416687) has the molecular formula C18H19FN6O2S
and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide.
Molecular Properties
| Compound Name | 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
| PubChem CID | 35416687 |
| Molecular Formula | C18H19FN6O2S |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CCN2Cn1nnc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H19FN6O2S/c1-23(2)28(26,27)16-7-8-17-14(11-16)9-10-24(17)12-25-21-18(20-22-25)13-3-5-15(19)6-4-13/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | JDICJALQFPQNKS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide?
The IUPAC name of 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide (CID 35416687) is 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide.
What is the SMILES notation for 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide?
The canonical SMILES for 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide is CN(C)S(=O)(=O)c1ccc2c(c1)CCN2Cn1nnc(-c2ccc(F)cc2)n1.
What is the InChIKey of 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide?
The InChIKey is JDICJALQFPQNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN6O2S/c1-23(2)28(26,27)16-7-8-17-14(11-16)9-10-24(17)12-25-21-18(20-22-25)13-3-5-15(19)6-4-13/h3-8,11H,9-10,12H2,1-2H3.
What are the key properties of 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide?
1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide has a molecular weight of 402.46 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide is sourced from PubChem (CID 35416687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).