C13H11FN2O — CID 3541776
3-(4-fluorophenyl)-1,5,6,7-tetrahydroindazol-4-one (PubChem CID 3541776) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,5,6,7-tetrahydroindazol-4-one.
| Compound Name | 3-(4-fluorophenyl)-1,5,6,7-tetrahydroindazol-4-one |
|---|---|
| PubChem CID | 3541776 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-(4-fluorophenyl)-1,5,6,7-tetrahydroindazol-4-one |
| SMILES | O=C1CCCc2[nH]nc(-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C13H11FN2O/c14-9-6-4-8(5-7-9)13-12-10(15-16-13)2-1-3-11(12)17/h4-7H,1-3H2,(H,15,16) |
| InChIKey | CFTORZQBDYFLNR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |