About 4-(ethylaminomethyl)-N,N-dimethylaniline
4-(ethylaminomethyl)-N,N-dimethylaniline (PubChem CID 3542461) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(ethylaminomethyl)-N,N-dimethylaniline |
| PubChem CID | 3542461 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-(ethylaminomethyl)-N,N-dimethylaniline |
| SMILES | CCNCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C11H18N2/c1-4-12-9-10-5-7-11(8-6-10)13(2)3/h5-8,12H,4,9H2,1-3H3 |
| InChIKey | JPQUAUQJXYRDKM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylaminomethyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylaminomethyl)-N,N-dimethylaniline?
The IUPAC name of 4-(ethylaminomethyl)-N,N-dimethylaniline (CID 3542461) is 4-(ethylaminomethyl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(ethylaminomethyl)-N,N-dimethylaniline?
The canonical SMILES for 4-(ethylaminomethyl)-N,N-dimethylaniline is CCNCc1ccc(N(C)C)cc1.
What is the InChIKey of 4-(ethylaminomethyl)-N,N-dimethylaniline?
The InChIKey is JPQUAUQJXYRDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-12-9-10-5-7-11(8-6-10)13(2)3/h5-8,12H,4,9H2,1-3H3.
What are the key properties of 4-(ethylaminomethyl)-N,N-dimethylaniline?
4-(ethylaminomethyl)-N,N-dimethylaniline has a molecular weight of 178.28 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylaminomethyl)-N,N-dimethylaniline is sourced from PubChem (CID 3542461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).