C20H13Cl2N3O4 — CID 3542830
ethyl 2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate (PubChem CID 3542830) has the molecular formula C20H13Cl2N3O4 and a molecular weight of 430.25 g/mol. Its IUPAC name is ethyl 2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3542830 |
| Molecular Formula | C20H13Cl2N3O4 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | ethyl 2-cyano-3-[2-(2,4-dichlorophenoxy)-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1c(Oc2ccc(Cl)cc2Cl)nc2ccccn2c1=O |
| InChI | InChI=1S/C20H13Cl2N3O4/c1-2-28-20(27)12(11-23)9-14-18(29-16-7-6-13(21)10-15(16)22)24-17-5-3-4-8-25(17)19(14)26/h3-10H,2H2,1H3 |
| InChIKey | WREUWRZLFFBPRE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|