C23H31N7 — CID 3543
2-N-(4-aminocyclohexyl)-6-N-benzyl-9-cyclopentylpurine-2,6-diamine (PubChem CID 3543) has the molecular formula C23H31N7 and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-benzyl-9-cyclopentylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-benzyl-9-cyclopentylpurine-2,6-diamine |
|---|---|
| PubChem CID | 3543 |
| Molecular Formula | C23H31N7 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-benzyl-9-cyclopentylpurine-2,6-diamine |
| SMILES | NC1CCC(Nc2nc(NCc3ccccc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C23H31N7/c24-17-10-12-18(13-11-17)27-23-28-21(25-14-16-6-2-1-3-7-16)20-22(29-23)30(15-26-20)19-8-4-5-9-19/h1-3,6-7,15,17-19H,4-5,8-14,24H2,(H2,25,27,28,29) |
| InChIKey | JTVILUUAQWQWBK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |