C17H17ClF3N5O3S — CID 3543207
N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]morpholine-4-carboximidamide (PubChem CID 3543207) has the molecular formula C17H17ClF3N5O3S and a molecular weight of 463.87 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]morpholine-4-carboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 3543207 |
| Molecular Formula | C17H17ClF3N5O3S |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]morpholine-4-carboximidamide |
| SMILES | O=S(=O)(N=C(NNc1ncc(C(F)(F)F)cc1Cl)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C17H17ClF3N5O3S/c18-14-10-12(17(19,20)21)11-22-15(14)23-24-16(26-6-8-29-9-7-26)25-30(27,28)13-4-2-1-3-5-13/h1-5,10-11H,6-9H2,(H,22,23)(H,24,25) |
| InChIKey | KYWSNCFSECYWNB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|