About (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone
(3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone (PubChem CID 35436100) has the molecular formula C14H15F2NO3
and a molecular weight of 283.27 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone.
Molecular Properties
| Compound Name | (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
| PubChem CID | 35436100 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H15F2NO3/c15-11-7-10(8-12(16)9-11)13(18)17-3-1-14(2-4-17)19-5-6-20-14/h7-9H,1-6H2 |
| InChIKey | KXLNQZLZWLVGQN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone?
The IUPAC name of (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone (CID 35436100) is (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone.
What is the SMILES notation for (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone?
The canonical SMILES for (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone is O=C(c1cc(F)cc(F)c1)N1CCC2(CC1)OCCO2.
What is the InChIKey of (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone?
The InChIKey is KXLNQZLZWLVGQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2NO3/c15-11-7-10(8-12(16)9-11)13(18)17-3-1-14(2-4-17)19-5-6-20-14/h7-9H,1-6H2.
What are the key properties of (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone?
(3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone has a molecular weight of 283.27 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl)-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone is sourced from PubChem (CID 35436100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).