C21H18F2N4O4S — CID 3544254
[2-(4-fluoroanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 3544254) has the molecular formula C21H18F2N4O4S and a molecular weight of 460.46 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 3544254 |
| Molecular Formula | C21H18F2N4O4S |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] N-(4-fluorophenyl)-4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | Cn1c(O)c(/C(=N/c2ccc(F)cc2)SCC(=O)Nc2ccc(F)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C21H18F2N4O4S/c1-26-19(29)17(20(30)27(2)21(26)31)18(25-15-9-5-13(23)6-10-15)32-11-16(28)24-14-7-3-12(22)4-8-14/h3-10,29H,11H2,1-2H3,(H,24,28)/b25-18- |
| InChIKey | XUENMLVAWFQIIZ-BWAHOGKJSA-N |
| XLogP | 2.52 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|