About 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole
1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole (PubChem CID 3544476) has the molecular formula C15H9F2N3O2
and a molecular weight of 301.25 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole |
| PubChem CID | 3544476 |
| Molecular Formula | C15H9F2N3O2 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole |
| SMILES | O=[N+]([O-])c1ccccc1-c1cnn(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H9F2N3O2/c16-11-5-6-15(13(17)7-11)19-9-10(8-18-19)12-3-1-2-4-14(12)20(21)22/h1-9H |
| InChIKey | QUNQZKAHQRXMDW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole?
The IUPAC name of 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole (CID 3544476) is 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole.
What is the SMILES notation for 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole?
The canonical SMILES for 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole is O=[N+]([O-])c1ccccc1-c1cnn(-c2ccc(F)cc2F)c1.
What is the InChIKey of 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole?
The InChIKey is QUNQZKAHQRXMDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F2N3O2/c16-11-5-6-15(13(17)7-11)19-9-10(8-18-19)12-3-1-2-4-14(12)20(21)22/h1-9H.
What are the key properties of 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole?
1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole has a molecular weight of 301.25 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-4-(2-nitrophenyl)pyrazole is sourced from PubChem (CID 3544476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).