C20H28F4N2O2 — CID 3545057
N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluorobutanediamide (PubChem CID 3545057) has the molecular formula C20H28F4N2O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluorobutanediamide.
| Compound Name | N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluorobutanediamide |
|---|---|
| PubChem CID | 3545057 |
| Molecular Formula | C20H28F4N2O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N,N'-bis[2-(cyclohexen-1-yl)ethyl]-2,2,3,3-tetrafluorobutanediamide |
| SMILES | O=C(NCCC1=CCCCC1)C(F)(F)C(F)(F)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H28F4N2O2/c21-19(22,17(27)25-13-11-15-7-3-1-4-8-15)20(23,24)18(28)26-14-12-16-9-5-2-6-10-16/h7,9H,1-6,8,10-14H2,(H,25,27)(H,26,28) |
| InChIKey | FDZSMZCFVZJZND-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|