C21H26N2O2S — CID 3545168
7-tert-butyl-2-(2-hydroxy-5-methylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3545168) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 7-tert-butyl-2-(2-hydroxy-5-methylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-tert-butyl-2-(2-hydroxy-5-methylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3545168 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 7-tert-butyl-2-(2-hydroxy-5-methylphenyl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(O)c(C2NC(=O)c3c(sc4c3CCC(C(C)(C)C)C4)N2)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-11-5-8-15(24)14(9-11)18-22-19(25)17-13-7-6-12(21(2,3)4)10-16(13)26-20(17)23-18/h5,8-9,12,18,23-24H,6-7,10H2,1-4H3,(H,22,25) |
| InChIKey | REGZUWSLUWBQAB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|