C9H14N2O2 — CID 3545680
5-amino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 3545680) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5-amino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 5-amino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 3545680 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 5-amino-2-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CN1C(=O)C2CCC(N)CC2C1=O |
| InChI | InChI=1S/C9H14N2O2/c1-11-8(12)6-3-2-5(10)4-7(6)9(11)13/h5-7H,2-4,10H2,1H3 |
| InChIKey | ZWBXUHHAGPPIKB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|