C22H16ClNO — CID 3545916
4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazine (PubChem CID 3545916) has the molecular formula C22H16ClNO and a molecular weight of 345.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazine.
| Compound Name | 4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazine |
|---|---|
| PubChem CID | 3545916 |
| Molecular Formula | C22H16ClNO |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-diphenyl-4H-1,3-oxazine |
| SMILES | Clc1ccc(C2C=C(c3ccccc3)OC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C22H16ClNO/c23-19-13-11-16(12-14-19)20-15-21(17-7-3-1-4-8-17)25-22(24-20)18-9-5-2-6-10-18/h1-15,20H |
| InChIKey | MJJWQDVKRMPXSW-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |