About 1-benzylpyrazole
1-benzylpyrazole (PubChem CID 3546441) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-benzylpyrazole.
Molecular Properties
| Compound Name | 1-benzylpyrazole |
| PubChem CID | 3546441 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 1-benzylpyrazole |
| SMILES | c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C10H10N2/c1-2-5-10(6-3-1)9-12-8-4-7-11-12/h1-8H,9H2 |
| InChIKey | AKQAJYLKBCWJBV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrazole?
The IUPAC name of 1-benzylpyrazole (CID 3546441) is 1-benzylpyrazole.
What is the SMILES notation for 1-benzylpyrazole?
The canonical SMILES for 1-benzylpyrazole is c1ccc(Cn2cccn2)cc1.
What is the InChIKey of 1-benzylpyrazole?
The InChIKey is AKQAJYLKBCWJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-5-10(6-3-1)9-12-8-4-7-11-12/h1-8H,9H2.
What are the key properties of 1-benzylpyrazole?
1-benzylpyrazole has a molecular weight of 158.20 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrazole is sourced from PubChem (CID 3546441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).