C15H8Cl3N3O2 — CID 3546448
2,5-dichloro-N-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 3546448) has the molecular formula C15H8Cl3N3O2 and a molecular weight of 368.61 g/mol. Its IUPAC name is 2,5-dichloro-N-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3546448 |
| Molecular Formula | C15H8Cl3N3O2 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 2,5-dichloro-N-[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2Cl)o1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H8Cl3N3O2/c16-8-5-6-12(18)10(7-8)13(22)19-15-21-20-14(23-15)9-3-1-2-4-11(9)17/h1-7H,(H,19,21,22) |
| InChIKey | LYMWWMGFFGTVBU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |