About 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione
5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione (PubChem CID 3546588) has the molecular formula C16H23N3S
and a molecular weight of 289.45 g/mol. Its IUPAC name is 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione |
| PubChem CID | 3546588 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(Cc2ccccc2)CN1C1CCCCC1 |
| InChI | InChI=1S/C16H23N3S/c20-16-17-12-18(11-14-7-3-1-4-8-14)13-19(16)15-9-5-2-6-10-15/h1,3-4,7-8,15H,2,5-6,9-13H2,(H,17,20) |
| InChIKey | HHQAKJWUVQMZCH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione?
The IUPAC name of 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione (CID 3546588) is 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione.
What is the SMILES notation for 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione?
The canonical SMILES for 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione is S=C1NCN(Cc2ccccc2)CN1C1CCCCC1.
What is the InChIKey of 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione?
The InChIKey is HHQAKJWUVQMZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3S/c20-16-17-12-18(11-14-7-3-1-4-8-14)13-19(16)15-9-5-2-6-10-15/h1,3-4,7-8,15H,2,5-6,9-13H2,(H,17,20).
What are the key properties of 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione?
5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione has a molecular weight of 289.45 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-1-cyclohexyl-1,3,5-triazinane-2-thione is sourced from PubChem (CID 3546588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).