C14H17N3O2S — CID 3547
5-(1,4-diazepan-1-ylsulfonyl)isoquinoline (PubChem CID 3547) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline |
|---|---|
| PubChem CID | 3547 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline |
| SMILES | O=S(=O)(c1cccc2cnccc12)N1CCCNCC1 |
| InChI | InChI=1S/C14H17N3O2S/c18-20(19,17-9-2-6-15-8-10-17)14-4-1-3-12-11-16-7-5-13(12)14/h1,3-5,7,11,15H,2,6,8-10H2 |
| InChIKey | NGOGFTYYXHNFQH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |