About [(4,4-dimethylcyclohexylidene)amino]thiourea
[(4,4-dimethylcyclohexylidene)amino]thiourea (PubChem CID 3547965) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is [(4,4-dimethylcyclohexylidene)amino]thiourea.
Molecular Properties
| Compound Name | [(4,4-dimethylcyclohexylidene)amino]thiourea |
| PubChem CID | 3547965 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | [(4,4-dimethylcyclohexylidene)amino]thiourea |
| SMILES | CC1(C)CCC(=NNC(N)=S)CC1 |
| InChI | InChI=1S/C9H17N3S/c1-9(2)5-3-7(4-6-9)11-12-8(10)13/h3-6H2,1-2H3,(H3,10,12,13) |
| InChIKey | UDZBZKJRGWFBEM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(4,4-dimethylcyclohexylidene)amino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4,4-dimethylcyclohexylidene)amino]thiourea?
The IUPAC name of [(4,4-dimethylcyclohexylidene)amino]thiourea (CID 3547965) is [(4,4-dimethylcyclohexylidene)amino]thiourea.
What is the SMILES notation for [(4,4-dimethylcyclohexylidene)amino]thiourea?
The canonical SMILES for [(4,4-dimethylcyclohexylidene)amino]thiourea is CC1(C)CCC(=NNC(N)=S)CC1.
What is the InChIKey of [(4,4-dimethylcyclohexylidene)amino]thiourea?
The InChIKey is UDZBZKJRGWFBEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-9(2)5-3-7(4-6-9)11-12-8(10)13/h3-6H2,1-2H3,(H3,10,12,13).
What are the key properties of [(4,4-dimethylcyclohexylidene)amino]thiourea?
[(4,4-dimethylcyclohexylidene)amino]thiourea has a molecular weight of 199.32 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4,4-dimethylcyclohexylidene)amino]thiourea is sourced from PubChem (CID 3547965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).