C10H16N2S4-2 — CID 3549534
N-[[4-[(sulfidocarbothioylamino)methyl]cyclohexyl]methyl]carbamodithioate (PubChem CID 3549534) has the molecular formula C10H16N2S4-2 and a molecular weight of 292.52 g/mol. Its IUPAC name is N-[[4-[(sulfidocarbothioylamino)methyl]cyclohexyl]methyl]carbamodithioate.
| Compound Name | N-[[4-[(sulfidocarbothioylamino)methyl]cyclohexyl]methyl]carbamodithioate |
|---|---|
| PubChem CID | 3549534 |
| Molecular Formula | C10H16N2S4-2 |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | N-[[4-[(sulfidocarbothioylamino)methyl]cyclohexyl]methyl]carbamodithioate |
| SMILES | S=C([S-])NCC1CCC(CNC(=S)[S-])CC1 |
| InChI | InChI=1S/C10H18N2S4/c13-9(14)11-5-7-1-2-8(4-3-7)6-12-10(15)16/h7-8H,1-6H2,(H2,11,13,14)(H2,12,15,16)/p-2 |
| InChIKey | ATCZBIMOYXCLNQ-UHFFFAOYSA-L |
| XLogP | 1.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|