About N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide
N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide (PubChem CID 3549654) has the molecular formula C21H25N3O3
and a molecular weight of 367.45 g/mol. Its IUPAC name is N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide |
| PubChem CID | 3549654 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1(O)c2ccccc2NC(=O)N1c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-5-15(4)22-19(25)21(27)17-8-6-7-9-18(17)23-20(26)24(21)16-11-10-13(2)14(3)12-16/h6-12,15,27H,5H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | GYAHORKMZOAYEE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
The IUPAC name of N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide (CID 3549654) is N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide.
What is the SMILES notation for N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
The canonical SMILES for N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide is CCC(C)NC(=O)C1(O)c2ccccc2NC(=O)N1c1ccc(C)c(C)c1.
What is the InChIKey of N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
The InChIKey is GYAHORKMZOAYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O3/c1-5-15(4)22-19(25)21(27)17-8-6-7-9-18(17)23-20(26)24(21)16-11-10-13(2)14(3)12-16/h6-12,15,27H,5H2,1-4H3,(H,22,25)(H,23,26).
What are the key properties of N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide?
N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide has a molecular weight of 367.45 g/mol, XLogP of 3.42, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3-(3,4-dimethylphenyl)-4-hydroxy-2-oxo-1H-quinazoline-4-carboxamide is sourced from PubChem (CID 3549654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).