C12H18N8S — CID 35500385
6-[(1S)-1-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 35500385) has the molecular formula C12H18N8S and a molecular weight of 306.40 g/mol. Its IUPAC name is 6-[(1S)-1-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S)-1-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 35500385 |
| Molecular Formula | C12H18N8S |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 6-[(1S)-1-[(4-cyclopropyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@H](Sc1nncn1C1CC1)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C12H18N8S/c1-7(9-15-10(13)17-11(16-9)19(2)3)21-12-18-14-6-20(12)8-4-5-8/h6-8H,4-5H2,1-3H3,(H2,13,15,16,17)/t7-/m0/s1 |
| InChIKey | FPOSPNLOBQILGA-ZETCQYMHSA-N |
| XLogP | 1.30 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |