About 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide
2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 3550423) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| PubChem CID | 3550423 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(NC(=O)C(C)C)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-5(2)7(11)10-8-9-4-6(3)12-8/h4-5H,1-3H3,(H,9,10,11) |
| InChIKey | SNYWNKRAPHMEFC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide?
The IUPAC name of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide (CID 3550423) is 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
What is the SMILES notation for 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide?
The canonical SMILES for 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide is Cc1cnc(NC(=O)C(C)C)s1.
What is the InChIKey of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide?
The InChIKey is SNYWNKRAPHMEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-5(2)7(11)10-8-9-4-6(3)12-8/h4-5H,1-3H3,(H,9,10,11).
What are the key properties of 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide?
2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide has a molecular weight of 184.26 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(5-methyl-1,3-thiazol-2-yl)propanamide is sourced from PubChem (CID 3550423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).