C19H29N3O5S — CID 35508539
ethyl 4-[5-(tert-butylsulfamoyl)-2-methylbenzoyl]piperazine-1-carboxylate (PubChem CID 35508539) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is ethyl 4-[5-(tert-butylsulfamoyl)-2-methylbenzoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[5-(tert-butylsulfamoyl)-2-methylbenzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 35508539 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | ethyl 4-[5-(tert-butylsulfamoyl)-2-methylbenzoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2cc(S(=O)(=O)NC(C)(C)C)ccc2C)CC1 |
| InChI | InChI=1S/C19H29N3O5S/c1-6-27-18(24)22-11-9-21(10-12-22)17(23)16-13-15(8-7-14(16)2)28(25,26)20-19(3,4)5/h7-8,13,20H,6,9-12H2,1-5H3 |
| InChIKey | SGHHUDAHNGMOCZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |