C18H13N3O5 — CID 3551881
N-acetyl-2-(3-nitrophenyl)iminochromene-3-carboxamide (PubChem CID 3551881) has the molecular formula C18H13N3O5 and a molecular weight of 351.32 g/mol. Its IUPAC name is N-acetyl-2-(3-nitrophenyl)iminochromene-3-carboxamide.
| Compound Name | N-acetyl-2-(3-nitrophenyl)iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 3551881 |
| Molecular Formula | C18H13N3O5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-acetyl-2-(3-nitrophenyl)iminochromene-3-carboxamide |
| SMILES | CC(=O)NC(=O)c1cc2ccccc2o/c1=N\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N3O5/c1-11(22)19-17(23)15-9-12-5-2-3-8-16(12)26-18(15)20-13-6-4-7-14(10-13)21(24)25/h2-10H,1H3,(H,19,22,23)/b20-18- |
| InChIKey | TZJISOAEYVVLOB-ZZEZOPTASA-N |
| XLogP | 2.85 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|