C13H13F2N3O — CID 35520962
N-[(2-ethylpyrazol-3-yl)methyl]-2,3-difluorobenzamide (PubChem CID 35520962) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is N-[(2-ethylpyrazol-3-yl)methyl]-2,3-difluorobenzamide.
| Compound Name | N-[(2-ethylpyrazol-3-yl)methyl]-2,3-difluorobenzamide |
|---|---|
| PubChem CID | 35520962 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[(2-ethylpyrazol-3-yl)methyl]-2,3-difluorobenzamide |
| SMILES | CCn1nccc1CNC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C13H13F2N3O/c1-2-18-9(6-7-17-18)8-16-13(19)10-4-3-5-11(14)12(10)15/h3-7H,2,8H2,1H3,(H,16,19) |
| InChIKey | OWFNAWNQZZLVIK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |