C18H18N4O4 — CID 35523602
furan-2-yl-[4-[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]piperazin-1-yl]methanone (PubChem CID 35523602) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is furan-2-yl-[4-[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 35523602 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | furan-2-yl-[4-[5-(pyrazol-1-ylmethyl)furan-2-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)c2ccc(Cn3cccn3)o2)CC1 |
| InChI | InChI=1S/C18H18N4O4/c23-17(15-3-1-12-25-15)20-8-10-21(11-9-20)18(24)16-5-4-14(26-16)13-22-7-2-6-19-22/h1-7,12H,8-11,13H2 |
| InChIKey | XCZGDDVLKQDRJT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |