C25H29FN2O4S — CID 35525317
N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 35525317) has the molecular formula C25H29FN2O4S and a molecular weight of 472.58 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 35525317 |
| Molecular Formula | C25H29FN2O4S |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC)c1ccc(CN(C(=O)c2oc3ccc(F)cc3c2C)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C25H29FN2O4S/c1-4-27(5-2)20-9-6-18(7-10-20)15-28(21-12-13-33(30,31)16-21)25(29)24-17(3)22-14-19(26)8-11-23(22)32-24/h6-11,14,21H,4-5,12-13,15-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | OPLYKWPVXVGFKO-NRFANRHFSA-N |
| XLogP | 4.56 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|