About nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol)
nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) (PubChem CID 3552662) has the molecular formula C26H24N4NiO2
and a molecular weight of 483.20 g/mol. Its IUPAC name is nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol).
Molecular Properties
| Compound Name | nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) |
| PubChem CID | 3552662 |
| Molecular Formula | C26H24N4NiO2 |
| Molecular Weight | 483.20 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) |
| SMILES | Oc1ccccc1/C=N/Cc1ccccn1.Oc1ccccc1C=NCc1ccccn1.[Ni] |
| InChI | InChI=1S/2C13H12N2O.Ni/c2*16-13-7-2-1-5-11(13)9-14-10-12-6-3-4-8-15-12;/h2*1-9,16H,10H2;/b14-9+;; |
| InChIKey | XGUKYBFYNMOHRP-CAJRCRMVSA-N |
| XLogP | 4.81 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol)?
The IUPAC name of nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) (CID 3552662) is nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol).
What is the SMILES notation for nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol)?
The canonical SMILES for nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) is Oc1ccccc1/C=N/Cc1ccccn1.Oc1ccccc1C=NCc1ccccn1.[Ni].
What is the InChIKey of nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol)?
The InChIKey is XGUKYBFYNMOHRP-CAJRCRMVSA-N. The full InChI is InChI=1S/2C13H12N2O.Ni/c2*16-13-7-2-1-5-11(13)9-14-10-12-6-3-4-8-15-12;/h2*1-9,16H,10H2;/b14-9+;;.
What are the key properties of nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol)?
nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) has a molecular weight of 483.20 g/mol, XLogP of 4.81, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;bis(2-(pyridin-2-ylmethyliminomethyl)phenol) is sourced from PubChem (CID 3552662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).