C21H24N2O2 — CID 35527670
1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(4-phenylphenoxy)ethanone (PubChem CID 35527670) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(4-phenylphenoxy)ethanone.
| Compound Name | 1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(4-phenylphenoxy)ethanone |
|---|---|
| PubChem CID | 35527670 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-(4-phenylphenoxy)ethanone |
| SMILES | O=C(COc1ccc(-c2ccccc2)cc1)N1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C21H24N2O2/c24-21(23-14-13-22-12-4-7-19(22)15-23)16-25-20-10-8-18(9-11-20)17-5-2-1-3-6-17/h1-3,5-6,8-11,19H,4,7,12-16H2/t19-/m1/s1 |
| InChIKey | JXXOAVBUUJIRHP-LJQANCHMSA-N |
| XLogP | 3.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |