C14H13BrF3N3O — CID 35529151
(2R)-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-phenylpropanamide (PubChem CID 35529151) has the molecular formula C14H13BrF3N3O and a molecular weight of 376.18 g/mol. Its IUPAC name is (2R)-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-phenylpropanamide.
| Compound Name | (2R)-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 35529151 |
| Molecular Formula | C14H13BrF3N3O |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | (2R)-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-phenylpropanamide |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1[C@H](C)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H13BrF3N3O/c1-8-11(15)12(14(16,17)18)20-21(8)9(2)13(22)19-10-6-4-3-5-7-10/h3-7,9H,1-2H3,(H,19,22)/t9-/m1/s1 |
| InChIKey | ACDOECRNNNTOMS-SECBINFHSA-N |
| XLogP | 4.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |