C16H18F3N3O — CID 35529711
1-methyl-N-[(1S)-1-(4-methylphenyl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide (PubChem CID 35529711) has the molecular formula C16H18F3N3O and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-1-(4-methylphenyl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide.
| Compound Name | 1-methyl-N-[(1S)-1-(4-methylphenyl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 35529711 |
| Molecular Formula | C16H18F3N3O |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-methyl-N-[(1S)-1-(4-methylphenyl)propyl]-3-(trifluoromethyl)pyrazole-5-carboxamide |
| SMILES | CC[C@H](NC(=O)c1cc(C(F)(F)F)nn1C)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H18F3N3O/c1-4-12(11-7-5-10(2)6-8-11)20-15(23)13-9-14(16(17,18)19)21-22(13)3/h5-9,12H,4H2,1-3H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | WGOLOKGCZIXQFT-LBPRGKRZSA-N |
| XLogP | 3.63 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |