C15H9Cl3N2O2 — CID 35532893
2-(1,2-benzoxazol-3-yl)-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 35532893) has the molecular formula C15H9Cl3N2O2 and a molecular weight of 355.61 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 35532893 |
| Molecular Formula | C15H9Cl3N2O2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(Cc1noc2ccccc12)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl3N2O2/c16-9-5-11(18)13(6-10(9)17)19-15(21)7-12-8-3-1-2-4-14(8)22-20-12/h1-6H,7H2,(H,19,21) |
| InChIKey | ZYYREENRGINECW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|